C29H33N3O2 — CID 57238379
1-benzyl-1-[(2R,4S)-2-benzyl-1-(3,5-dimethylbenzoyl)piperidin-4-yl]urea (PubChem CID 57238379) has the molecular formula C29H33N3O2 and a molecular weight of 455.60 g/mol. Its IUPAC name is 1-benzyl-1-[(2R,4S)-2-benzyl-1-(3,5-dimethylbenzoyl)piperidin-4-yl]urea.
| Compound Name | 1-benzyl-1-[(2R,4S)-2-benzyl-1-(3,5-dimethylbenzoyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 57238379 |
| Molecular Formula | C29H33N3O2 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | 1-benzyl-1-[(2R,4S)-2-benzyl-1-(3,5-dimethylbenzoyl)piperidin-4-yl]urea |
| SMILES | Cc1cc(C)cc(C(=O)N2CC[C@H](N(Cc3ccccc3)C(N)=O)C[C@H]2Cc2ccccc2)c1 |
| InChI | InChI=1S/C29H33N3O2/c1-21-15-22(2)17-25(16-21)28(33)31-14-13-26(19-27(31)18-23-9-5-3-6-10-23)32(29(30)34)20-24-11-7-4-8-12-24/h3-12,15-17,26-27H,13-14,18-20H2,1-2H3,(H2,30,34)/t26-,27+/m0/s1 |
| InChIKey | FLSDRAKNIJGJHV-RRPNLBNLSA-N |
| XLogP | 5.10 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |