C18H22N2O3 — CID 54490680
5-(4-methoxyphenyl)-N-(2-oxoazepan-4-yl)penta-2,4-dienamide (PubChem CID 54490680) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-N-(2-oxoazepan-4-yl)penta-2,4-dienamide.
| Compound Name | 5-(4-methoxyphenyl)-N-(2-oxoazepan-4-yl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 54490680 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 5-(4-methoxyphenyl)-N-(2-oxoazepan-4-yl)penta-2,4-dienamide |
| SMILES | COc1ccc(C=CC=CC(=O)NC2CCCNC(=O)C2)cc1 |
| InChI | InChI=1S/C18H22N2O3/c1-23-16-10-8-14(9-11-16)5-2-3-7-17(21)20-15-6-4-12-19-18(22)13-15/h2-3,5,7-11,15H,4,6,12-13H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | XVMUBRDBMXDUOT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|