C17H19NO5S — CID 54490897
(5-cyclopropyl-1,2-oxazol-4-yl)-[3-(2-methoxyethoxy)-2-methylsulfinylphenyl]methanone (PubChem CID 54490897) has the molecular formula C17H19NO5S and a molecular weight of 349.41 g/mol. Its IUPAC name is (5-cyclopropyl-1,2-oxazol-4-yl)-[3-(2-methoxyethoxy)-2-methylsulfinylphenyl]methanone.
| Compound Name | (5-cyclopropyl-1,2-oxazol-4-yl)-[3-(2-methoxyethoxy)-2-methylsulfinylphenyl]methanone |
|---|---|
| PubChem CID | 54490897 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | (5-cyclopropyl-1,2-oxazol-4-yl)-[3-(2-methoxyethoxy)-2-methylsulfinylphenyl]methanone |
| SMILES | COCCOc1cccc(C(=O)c2cnoc2C2CC2)c1S(C)=O |
| InChI | InChI=1S/C17H19NO5S/c1-21-8-9-22-14-5-3-4-12(17(14)24(2)20)15(19)13-10-18-23-16(13)11-6-7-11/h3-5,10-11H,6-9H2,1-2H3 |
| InChIKey | XVQJRXGZXRQBJO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|