C16H29NO3 — CID 54491033
methyl 2-ethyl-6-methyl-4-(2-oxopyrrolidin-1-yl)octanoate (PubChem CID 54491033) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is methyl 2-ethyl-6-methyl-4-(2-oxopyrrolidin-1-yl)octanoate.
| Compound Name | methyl 2-ethyl-6-methyl-4-(2-oxopyrrolidin-1-yl)octanoate |
|---|---|
| PubChem CID | 54491033 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | methyl 2-ethyl-6-methyl-4-(2-oxopyrrolidin-1-yl)octanoate |
| SMILES | CCC(C)CC(CC(CC)C(=O)OC)N1CCCC1=O |
| InChI | InChI=1S/C16H29NO3/c1-5-12(3)10-14(17-9-7-8-15(17)18)11-13(6-2)16(19)20-4/h12-14H,5-11H2,1-4H3 |
| InChIKey | XVSPXFVZXVJFSZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |