About acridin-9-yl hydrogen carbonate
acridin-9-yl hydrogen carbonate (PubChem CID 54493221) has the molecular formula C14H9NO3
and a molecular weight of 239.23 g/mol. Its IUPAC name is acridin-9-yl hydrogen carbonate.
Molecular Properties
| Compound Name | acridin-9-yl hydrogen carbonate |
| PubChem CID | 54493221 |
| Molecular Formula | C14H9NO3 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | acridin-9-yl hydrogen carbonate |
| SMILES | O=C(O)Oc1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C14H9NO3/c16-14(17)18-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H,(H,16,17) |
| InChIKey | XXGABQZQTYGOIU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze acridin-9-yl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acridin-9-yl hydrogen carbonate?
The IUPAC name of acridin-9-yl hydrogen carbonate (CID 54493221) is acridin-9-yl hydrogen carbonate.
What is the SMILES notation for acridin-9-yl hydrogen carbonate?
The canonical SMILES for acridin-9-yl hydrogen carbonate is O=C(O)Oc1c2ccccc2nc2ccccc12.
What is the InChIKey of acridin-9-yl hydrogen carbonate?
The InChIKey is XXGABQZQTYGOIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9NO3/c16-14(17)18-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H,(H,16,17).
What are the key properties of acridin-9-yl hydrogen carbonate?
acridin-9-yl hydrogen carbonate has a molecular weight of 239.23 g/mol, XLogP of 3.44, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acridin-9-yl hydrogen carbonate is sourced from PubChem (CID 54493221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).