About (2-methylquinolin-3-yl) hydrogen carbonate
(2-methylquinolin-3-yl) hydrogen carbonate (PubChem CID 70380848) has the molecular formula C11H9NO3
and a molecular weight of 203.20 g/mol. Its IUPAC name is (2-methylquinolin-3-yl) hydrogen carbonate.
Molecular Properties
| Compound Name | (2-methylquinolin-3-yl) hydrogen carbonate |
| PubChem CID | 70380848 |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | (2-methylquinolin-3-yl) hydrogen carbonate |
| SMILES | Cc1nc2ccccc2cc1OC(=O)O |
| InChI | InChI=1S/C11H9NO3/c1-7-10(15-11(13)14)6-8-4-2-3-5-9(8)12-7/h2-6H,1H3,(H,13,14) |
| InChIKey | RAFBJOWGRIXHBG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-methylquinolin-3-yl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylquinolin-3-yl) hydrogen carbonate?
The IUPAC name of (2-methylquinolin-3-yl) hydrogen carbonate (CID 70380848) is (2-methylquinolin-3-yl) hydrogen carbonate.
What is the SMILES notation for (2-methylquinolin-3-yl) hydrogen carbonate?
The canonical SMILES for (2-methylquinolin-3-yl) hydrogen carbonate is Cc1nc2ccccc2cc1OC(=O)O.
What is the InChIKey of (2-methylquinolin-3-yl) hydrogen carbonate?
The InChIKey is RAFBJOWGRIXHBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO3/c1-7-10(15-11(13)14)6-8-4-2-3-5-9(8)12-7/h2-6H,1H3,(H,13,14).
What are the key properties of (2-methylquinolin-3-yl) hydrogen carbonate?
(2-methylquinolin-3-yl) hydrogen carbonate has a molecular weight of 203.20 g/mol, XLogP of 2.60, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylquinolin-3-yl) hydrogen carbonate is sourced from PubChem (CID 70380848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).