C21H17F3NOS+ — CID 54497777
3-ethyl-2-[(4-methylchromen-2-ylidene)methyl]-5-(trifluoromethyl)-1,3-benzothiazol-3-ium (PubChem CID 54497777) has the molecular formula C21H17F3NOS+ and a molecular weight of 388.43 g/mol. Its IUPAC name is 3-ethyl-2-[(4-methylchromen-2-ylidene)methyl]-5-(trifluoromethyl)-1,3-benzothiazol-3-ium.
| Compound Name | 3-ethyl-2-[(4-methylchromen-2-ylidene)methyl]-5-(trifluoromethyl)-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 54497777 |
| Molecular Formula | C21H17F3NOS+ |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 3-ethyl-2-[(4-methylchromen-2-ylidene)methyl]-5-(trifluoromethyl)-1,3-benzothiazol-3-ium |
| SMILES | CC[n+]1c(C=C2C=C(C)c3ccccc3O2)sc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C21H17F3NOS/c1-3-25-17-11-14(21(22,23)24)8-9-19(17)27-20(25)12-15-10-13(2)16-6-4-5-7-18(16)26-15/h4-12H,3H2,1-2H3/q+1 |
| InChIKey | YAIJOPYQKBOZLK-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|