C20H28O8 — CID 54499802
[(2R,3R)-1-[2-(hydroxymethyl)-1,3-dioxolan-2-yl]-3-(2-methoxyethoxymethoxy)pent-4-en-2-yl] benzoate (PubChem CID 54499802) has the molecular formula C20H28O8 and a molecular weight of 396.44 g/mol. Its IUPAC name is [(2R,3R)-1-[2-(hydroxymethyl)-1,3-dioxolan-2-yl]-3-(2-methoxyethoxymethoxy)pent-4-en-2-yl] benzoate.
| Compound Name | [(2R,3R)-1-[2-(hydroxymethyl)-1,3-dioxolan-2-yl]-3-(2-methoxyethoxymethoxy)pent-4-en-2-yl] benzoate |
|---|---|
| PubChem CID | 54499802 |
| Molecular Formula | C20H28O8 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | [(2R,3R)-1-[2-(hydroxymethyl)-1,3-dioxolan-2-yl]-3-(2-methoxyethoxymethoxy)pent-4-en-2-yl] benzoate |
| SMILES | C=C[C@@H](OCOCCOC)[C@@H](CC1(CO)OCCO1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H28O8/c1-3-17(25-15-24-10-9-23-2)18(13-20(14-21)26-11-12-27-20)28-19(22)16-7-5-4-6-8-16/h3-8,17-18,21H,1,9-15H2,2H3/t17-,18-/m1/s1 |
| InChIKey | YBQARNHNRUMXMV-QZTJIDSGSA-N |
| XLogP | 1.53 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|