C16H21ClO — CID 54500952
trans-(1R,3R)-3-(4-butan-2-ylphenyl)-2,2-dimethylcyclopropane-1-carbonyl chloride (PubChem CID 54500952) has the molecular formula C16H21ClO and a molecular weight of 264.80 g/mol. Its IUPAC name is trans-(1R,3R)-3-(4-butan-2-ylphenyl)-2,2-dimethylcyclopropane-1-carbonyl chloride.
| Compound Name | trans-(1R,3R)-3-(4-butan-2-ylphenyl)-2,2-dimethylcyclopropane-1-carbonyl chloride |
|---|---|
| PubChem CID | 54500952 |
| Molecular Formula | C16H21ClO |
| Molecular Weight | 264.80 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | trans-(1R,3R)-3-(4-butan-2-ylphenyl)-2,2-dimethylcyclopropane-1-carbonyl chloride |
| SMILES | CCC(C)c1ccc([C@@H]2[C@@H](C(=O)Cl)C2(C)C)cc1 |
| InChI | InChI=1S/C16H21ClO/c1-5-10(2)11-6-8-12(9-7-11)13-14(15(17)18)16(13,3)4/h6-10,13-14H,5H2,1-4H3/t10?,13-,14+/m1/s1 |
| InChIKey | YCJLLLIEZOYJHP-ADSMYIAOSA-N |
| XLogP | 4.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.80 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|