C15H19ClO — CID 54142165
trans-(1R,3R)-2,2-dimethyl-3-(4-propan-2-ylphenyl)cyclopropane-1-carbonyl chloride (PubChem CID 54142165) has the molecular formula C15H19ClO and a molecular weight of 250.77 g/mol. Its IUPAC name is trans-(1R,3R)-2,2-dimethyl-3-(4-propan-2-ylphenyl)cyclopropane-1-carbonyl chloride.
| Compound Name | trans-(1R,3R)-2,2-dimethyl-3-(4-propan-2-ylphenyl)cyclopropane-1-carbonyl chloride |
|---|---|
| PubChem CID | 54142165 |
| Molecular Formula | C15H19ClO |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | trans-(1R,3R)-2,2-dimethyl-3-(4-propan-2-ylphenyl)cyclopropane-1-carbonyl chloride |
| SMILES | CC(C)c1ccc([C@@H]2[C@@H](C(=O)Cl)C2(C)C)cc1 |
| InChI | InChI=1S/C15H19ClO/c1-9(2)10-5-7-11(8-6-10)12-13(14(16)17)15(12,3)4/h5-9,12-13H,1-4H3/t12-,13+/m1/s1 |
| InChIKey | OBVTWFQHBZREIE-OLZOCXBDSA-N |
| XLogP | 4.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|