C26H31N7O2 — CID 54502227
4-[2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-yl]decanoic acid (PubChem CID 54502227) has the molecular formula C26H31N7O2 and a molecular weight of 473.58 g/mol. Its IUPAC name is 4-[2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-yl]decanoic acid.
| Compound Name | 4-[2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-yl]decanoic acid |
|---|---|
| PubChem CID | 54502227 |
| Molecular Formula | C26H31N7O2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | 4-[2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-yl]decanoic acid |
| SMILES | CCCCCCC(CCC(=O)O)c1ncnn1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C26H31N7O2/c1-2-3-4-5-8-21(15-16-24(34)35)26-27-18-28-33(26)17-19-11-13-20(14-12-19)22-9-6-7-10-23(22)25-29-31-32-30-25/h6-7,9-14,18,21H,2-5,8,15-17H2,1H3,(H,34,35)(H,29,30,31,32) |
| InChIKey | YDFSMDSFMLYSEE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 122.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|