C20H38N4O4 — CID 54502830
ethyl 2-[4-[4-[2-(butoxycarbonylamino)ethyl]piperazin-1-yl]piperidin-1-yl]acetate (PubChem CID 54502830) has the molecular formula C20H38N4O4 and a molecular weight of 398.55 g/mol. Its IUPAC name is ethyl 2-[4-[4-[2-(butoxycarbonylamino)ethyl]piperazin-1-yl]piperidin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[4-[2-(butoxycarbonylamino)ethyl]piperazin-1-yl]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 54502830 |
| Molecular Formula | C20H38N4O4 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | ethyl 2-[4-[4-[2-(butoxycarbonylamino)ethyl]piperazin-1-yl]piperidin-1-yl]acetate |
| SMILES | CCCCOC(=O)NCCN1CCN(C2CCN(CC(=O)OCC)CC2)CC1 |
| InChI | InChI=1S/C20H38N4O4/c1-3-5-16-28-20(26)21-8-11-22-12-14-24(15-13-22)18-6-9-23(10-7-18)17-19(25)27-4-2/h18H,3-17H2,1-2H3,(H,21,26) |
| InChIKey | YDQLUVMPGXQEDR-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|