C15H20O4S — CID 54504157
6-[2-[5-(hydroxymethyl)thiophen-2-yl]ethyl]-6-propan-2-yloxane-2,4-dione (PubChem CID 54504157) has the molecular formula C15H20O4S and a molecular weight of 296.39 g/mol. Its IUPAC name is 6-[2-[5-(hydroxymethyl)thiophen-2-yl]ethyl]-6-propan-2-yloxane-2,4-dione.
| Compound Name | 6-[2-[5-(hydroxymethyl)thiophen-2-yl]ethyl]-6-propan-2-yloxane-2,4-dione |
|---|---|
| PubChem CID | 54504157 |
| Molecular Formula | C15H20O4S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 6-[2-[5-(hydroxymethyl)thiophen-2-yl]ethyl]-6-propan-2-yloxane-2,4-dione |
| SMILES | CC(C)C1(CCc2ccc(CO)s2)CC(=O)CC(=O)O1 |
| InChI | InChI=1S/C15H20O4S/c1-10(2)15(8-11(17)7-14(18)19-15)6-5-12-3-4-13(9-16)20-12/h3-4,10,16H,5-9H2,1-2H3 |
| InChIKey | YENFGGQSXHRJGD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|