C30H27N9S — CID 54504396
methyl 2,2-dicyano-N-[7-methyl-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazol-5-yl]ethanimidothioate (PubChem CID 54504396) has the molecular formula C30H27N9S and a molecular weight of 545.68 g/mol. Its IUPAC name is methyl 2,2-dicyano-N-[7-methyl-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazol-5-yl]ethanimidothioate.
| Compound Name | methyl 2,2-dicyano-N-[7-methyl-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazol-5-yl]ethanimidothioate |
|---|---|
| PubChem CID | 54504396 |
| Molecular Formula | C30H27N9S |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | methyl 2,2-dicyano-N-[7-methyl-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazol-5-yl]ethanimidothioate |
| SMILES | CCCc1nc2c(C)cc(/N=C(\SC)C(C#N)C#N)cc2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C30H27N9S/c1-4-7-27-34-28-19(2)14-23(33-30(40-3)22(16-31)17-32)15-26(28)39(27)18-20-10-12-21(13-11-20)24-8-5-6-9-25(24)29-35-37-38-36-29/h5-6,8-15,22H,4,7,18H2,1-3H3,(H,35,36,37,38)/b33-30- |
| InChIKey | YERGULREVBKSRH-MEIHLTSWSA-N |
| XLogP | 6.25 |
| TPSA | 132.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|