C27H25ClN8O2S — CID 67732906
7-chloro-N-(1-methylsulfanyl-2-nitroethenyl)-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazol-5-amine (PubChem CID 67732906) has the molecular formula C27H25ClN8O2S and a molecular weight of 561.07 g/mol. Its IUPAC name is 7-chloro-N-(1-methylsulfanyl-2-nitroethenyl)-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazol-5-amine.
| Compound Name | 7-chloro-N-(1-methylsulfanyl-2-nitroethenyl)-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazol-5-amine |
|---|---|
| PubChem CID | 67732906 |
| Molecular Formula | C27H25ClN8O2S |
| Molecular Weight | 561.07 g/mol |
| Exact Mass | 560.15 |
| IUPAC Name | 7-chloro-N-(1-methylsulfanyl-2-nitroethenyl)-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazol-5-amine |
| SMILES | CCCc1nc2c(Cl)cc(NC(=C[N+](=O)[O-])SC)cc2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C27H25ClN8O2S/c1-3-6-24-30-26-22(28)13-19(29-25(39-2)16-36(37)38)14-23(26)35(24)15-17-9-11-18(12-10-17)20-7-4-5-8-21(20)27-31-33-34-32-27/h4-5,7-14,16,29H,3,6,15H2,1-2H3,(H,31,32,33,34) |
| InChIKey | SMIUALSVBRQLDJ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.07 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|