C31H33N9O3 — CID 67732947
7-methyl-N-(1-morpholin-4-yl-2-nitroethenyl)-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazol-5-amine (PubChem CID 67732947) has the molecular formula C31H33N9O3 and a molecular weight of 579.67 g/mol. Its IUPAC name is 7-methyl-N-(1-morpholin-4-yl-2-nitroethenyl)-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazol-5-amine.
| Compound Name | 7-methyl-N-(1-morpholin-4-yl-2-nitroethenyl)-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazol-5-amine |
|---|---|
| PubChem CID | 67732947 |
| Molecular Formula | C31H33N9O3 |
| Molecular Weight | 579.67 g/mol |
| Exact Mass | 579.27 |
| IUPAC Name | 7-methyl-N-(1-morpholin-4-yl-2-nitroethenyl)-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazol-5-amine |
| SMILES | CCCc1nc2c(C)cc(NC(=C[N+](=O)[O-])N3CCOCC3)cc2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C31H33N9O3/c1-3-6-28-33-30-21(2)17-24(32-29(20-40(41)42)38-13-15-43-16-14-38)18-27(30)39(28)19-22-9-11-23(12-10-22)25-7-4-5-8-26(25)31-34-36-37-35-31/h4-5,7-12,17-18,20,32H,3,6,13-16,19H2,1-2H3,(H,34,35,36,37) |
| InChIKey | CJILQCWZLWMOAC-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 139.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.67 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|