C27H46N2O5 — CID 54504792
[3-[2-(2-benzyldecylamino)ethylcarbamoyloxy]-2-hydroxypropyl] 2-methylpropanoate (PubChem CID 54504792) has the molecular formula C27H46N2O5 and a molecular weight of 478.67 g/mol. Its IUPAC name is [3-[2-(2-benzyldecylamino)ethylcarbamoyloxy]-2-hydroxypropyl] 2-methylpropanoate.
| Compound Name | [3-[2-(2-benzyldecylamino)ethylcarbamoyloxy]-2-hydroxypropyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 54504792 |
| Molecular Formula | C27H46N2O5 |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.34 |
| IUPAC Name | [3-[2-(2-benzyldecylamino)ethylcarbamoyloxy]-2-hydroxypropyl] 2-methylpropanoate |
| SMILES | CCCCCCCCC(CNCCNC(=O)OCC(O)COC(=O)C(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C27H46N2O5/c1-4-5-6-7-8-10-15-24(18-23-13-11-9-12-14-23)19-28-16-17-29-27(32)34-21-25(30)20-33-26(31)22(2)3/h9,11-14,22,24-25,28,30H,4-8,10,15-21H2,1-3H3,(H,29,32) |
| InChIKey | YEXVDPLHVJOTDY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|