C22H38N2O3 — CID 22067466
2-hydroxyethyl N-[1-(2-benzyldecylamino)ethyl]carbamate (PubChem CID 22067466) has the molecular formula C22H38N2O3 and a molecular weight of 378.56 g/mol. Its IUPAC name is 2-hydroxyethyl N-[1-(2-benzyldecylamino)ethyl]carbamate.
| Compound Name | 2-hydroxyethyl N-[1-(2-benzyldecylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 22067466 |
| Molecular Formula | C22H38N2O3 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.29 |
| IUPAC Name | 2-hydroxyethyl N-[1-(2-benzyldecylamino)ethyl]carbamate |
| SMILES | CCCCCCCCC(CNC(C)NC(=O)OCCO)Cc1ccccc1 |
| InChI | InChI=1S/C22H38N2O3/c1-3-4-5-6-7-9-14-21(17-20-12-10-8-11-13-20)18-23-19(2)24-22(26)27-16-15-25/h8,10-13,19,21,23,25H,3-7,9,14-18H2,1-2H3,(H,24,26) |
| InChIKey | YZYDUCQYFBYCLF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|