C28H46N2O4 — CID 56985786
[4-(2-benzyldodecylamino)-2-carbamoyloxybutyl] 2-methylprop-2-enoate (PubChem CID 56985786) has the molecular formula C28H46N2O4 and a molecular weight of 474.69 g/mol. Its IUPAC name is [4-(2-benzyldodecylamino)-2-carbamoyloxybutyl] 2-methylprop-2-enoate.
| Compound Name | [4-(2-benzyldodecylamino)-2-carbamoyloxybutyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 56985786 |
| Molecular Formula | C28H46N2O4 |
| Molecular Weight | 474.69 g/mol |
| Exact Mass | 474.35 |
| IUPAC Name | [4-(2-benzyldodecylamino)-2-carbamoyloxybutyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CCNCC(CCCCCCCCCC)Cc1ccccc1)OC(N)=O |
| InChI | InChI=1S/C28H46N2O4/c1-4-5-6-7-8-9-10-12-17-25(20-24-15-13-11-14-16-24)21-30-19-18-26(34-28(29)32)22-33-27(31)23(2)3/h11,13-16,25-26,30H,2,4-10,12,17-22H2,1,3H3,(H2,29,32) |
| InChIKey | QDSOUOADLFYFTD-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.69 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|