C16H22N4O3 — CID 54506967
tert-butyl 8-hydroxy-9-methyl-2,4,8,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),4,6,12-tetraene-12-carboxylate (PubChem CID 54506967) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is tert-butyl 8-hydroxy-9-methyl-2,4,8,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),4,6,12-tetraene-12-carboxylate.
| Compound Name | tert-butyl 8-hydroxy-9-methyl-2,4,8,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),4,6,12-tetraene-12-carboxylate |
|---|---|
| PubChem CID | 54506967 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | tert-butyl 8-hydroxy-9-methyl-2,4,8,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),4,6,12-tetraene-12-carboxylate |
| SMILES | CC1C2CC(C(=O)OC(C)(C)C)=CN=C2N2CN=CC2=CN1O |
| InChI | InChI=1S/C16H22N4O3/c1-10-13-5-11(15(21)23-16(2,3)4)6-18-14(13)19-9-17-7-12(19)8-20(10)22/h6-8,10,13,22H,5,9H2,1-4H3 |
| InChIKey | YGKGBDDMMQPBRN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 77.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |