tert-butyl 2,5-dihydrofuran-3-carboxylate

C9H14O3 — CID 11206018

IUPACtert-butyl 2,5-dihydrofuran-3-carboxylate
SMILESCC(C)(C)OC(=O)C1=CCOC1
InChIInChI=1S/C9H14O3/c1-9(2,3)12-8(10)7-4-5-11-6-7/h4H,5-6H2,1-3H3
InChIKeySEBXANQHCVSIRF-UHFFFAOYSA-N
MW170.21 g/mol
LogP1.28
Rot. Bonds1

About tert-butyl 2,5-dihydrofuran-3-carboxylate

tert-butyl 2,5-dihydrofuran-3-carboxylate (PubChem CID 11206018) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is tert-butyl 2,5-dihydrofuran-3-carboxylate.

Molecular Properties

Compound Nametert-butyl 2,5-dihydrofuran-3-carboxylate
PubChem CID11206018
Molecular FormulaC9H14O3
Molecular Weight170.21 g/mol
Exact Mass170.09
IUPAC Nametert-butyl 2,5-dihydrofuran-3-carboxylate
SMILESCC(C)(C)OC(=O)C1=CCOC1
InChIInChI=1S/C9H14O3/c1-9(2,3)12-8(10)7-4-5-11-6-7/h4H,5-6H2,1-3H3
InChIKeySEBXANQHCVSIRF-UHFFFAOYSA-N
XLogP1.28
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.21
LogP ≤ 51.28
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze tert-butyl 2,5-dihydrofuran-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl 2,5-dihydrofuran-3-carboxylate?
The IUPAC name of tert-butyl 2,5-dihydrofuran-3-carboxylate (CID 11206018) is tert-butyl 2,5-dihydrofuran-3-carboxylate.
What is the SMILES notation for tert-butyl 2,5-dihydrofuran-3-carboxylate?
The canonical SMILES for tert-butyl 2,5-dihydrofuran-3-carboxylate is CC(C)(C)OC(=O)C1=CCOC1.
What is the InChIKey of tert-butyl 2,5-dihydrofuran-3-carboxylate?
The InChIKey is SEBXANQHCVSIRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3/c1-9(2,3)12-8(10)7-4-5-11-6-7/h4H,5-6H2,1-3H3.
What are the key properties of tert-butyl 2,5-dihydrofuran-3-carboxylate?
tert-butyl 2,5-dihydrofuran-3-carboxylate has a molecular weight of 170.21 g/mol, XLogP of 1.28, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2,5-dihydrofuran-3-carboxylate is sourced from PubChem (CID 11206018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).