C14H23NO4 — CID 178202810
tert-butyl (3S,4R)-3-(3,6-dihydro-2H-pyran-4-yl)-4-hydroxypyrrolidine-1-carboxylate (PubChem CID 178202810) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is tert-butyl (3S,4R)-3-(3,6-dihydro-2H-pyran-4-yl)-4-hydroxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4R)-3-(3,6-dihydro-2H-pyran-4-yl)-4-hydroxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 178202810 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | tert-butyl (3S,4R)-3-(3,6-dihydro-2H-pyran-4-yl)-4-hydroxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C2=CCOCC2)[C@@H](O)C1 |
| InChI | InChI=1S/C14H23NO4/c1-14(2,3)19-13(17)15-8-11(12(16)9-15)10-4-6-18-7-5-10/h4,11-12,16H,5-9H2,1-3H3/t11-,12+/m1/s1 |
| InChIKey | FXUJGDQXDKWFDX-NEPJUHHUSA-N |
| XLogP | 1.56 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|