C16H18N4 — CID 54507850
4-phenyl-3,5-dihydro-2H-1,4-benzodiazepine-1-carboximidamide (PubChem CID 54507850) has the molecular formula C16H18N4 and a molecular weight of 266.35 g/mol. Its IUPAC name is 4-phenyl-3,5-dihydro-2H-1,4-benzodiazepine-1-carboximidamide.
| Compound Name | 4-phenyl-3,5-dihydro-2H-1,4-benzodiazepine-1-carboximidamide |
|---|---|
| PubChem CID | 54507850 |
| Molecular Formula | C16H18N4 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 4-phenyl-3,5-dihydro-2H-1,4-benzodiazepine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCN(c2ccccc2)Cc2ccccc21 |
| InChI | InChI=1S/C16H18N4/c17-16(18)20-11-10-19(14-7-2-1-3-8-14)12-13-6-4-5-9-15(13)20/h1-9H,10-12H2,(H3,17,18) |
| InChIKey | YGZDFCLVLCBQOZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|