C19H19NO2S2 — CID 54508249
4-hydroxy-5-[[4-(3-phenylpropylsulfanyl)phenyl]methyl]-3H-1,3-thiazol-2-one (PubChem CID 54508249) has the molecular formula C19H19NO2S2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 4-hydroxy-5-[[4-(3-phenylpropylsulfanyl)phenyl]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-hydroxy-5-[[4-(3-phenylpropylsulfanyl)phenyl]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 54508249 |
| Molecular Formula | C19H19NO2S2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 4-hydroxy-5-[[4-(3-phenylpropylsulfanyl)phenyl]methyl]-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(O)c(Cc2ccc(SCCCc3ccccc3)cc2)s1 |
| InChI | InChI=1S/C19H19NO2S2/c21-18-17(24-19(22)20-18)13-15-8-10-16(11-9-15)23-12-4-7-14-5-2-1-3-6-14/h1-3,5-6,8-11,21H,4,7,12-13H2,(H,20,22) |
| InChIKey | YHGGJXGNNPLXBW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|