C10H21O4P — CID 54512413
3-[hydroxy(2-methylpentyl)phosphoryl]-2-methylpropanoic acid (PubChem CID 54512413) has the molecular formula C10H21O4P and a molecular weight of 236.25 g/mol. Its IUPAC name is 3-[hydroxy(2-methylpentyl)phosphoryl]-2-methylpropanoic acid.
| Compound Name | 3-[hydroxy(2-methylpentyl)phosphoryl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 54512413 |
| Molecular Formula | C10H21O4P |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 3-[hydroxy(2-methylpentyl)phosphoryl]-2-methylpropanoic acid |
| SMILES | CCCC(C)CP(=O)(O)CC(C)C(=O)O |
| InChI | InChI=1S/C10H21O4P/c1-4-5-8(2)6-15(13,14)7-9(3)10(11)12/h8-9H,4-7H2,1-3H3,(H,11,12)(H,13,14) |
| InChIKey | YKBIUOFJBZRNRX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|