C13H20FO2P — CID 139902943
(2-fluorophenyl)methyl-(2-methylpentyl)phosphinic acid (PubChem CID 139902943) has the molecular formula C13H20FO2P and a molecular weight of 258.27 g/mol. Its IUPAC name is (2-fluorophenyl)methyl-(2-methylpentyl)phosphinic acid.
| Compound Name | (2-fluorophenyl)methyl-(2-methylpentyl)phosphinic acid |
|---|---|
| PubChem CID | 139902943 |
| Molecular Formula | C13H20FO2P |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | (2-fluorophenyl)methyl-(2-methylpentyl)phosphinic acid |
| SMILES | CCCC(C)CP(=O)(O)Cc1ccccc1F |
| InChI | InChI=1S/C13H20FO2P/c1-3-6-11(2)9-17(15,16)10-12-7-4-5-8-13(12)14/h4-5,7-8,11H,3,6,9-10H2,1-2H3,(H,15,16) |
| InChIKey | NTGPHSDEBQTYMN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|