C15H24NO2P — CID 21338268
N-[[methyl(2-methylpentyl)phosphoryl]methyl]benzamide (PubChem CID 21338268) has the molecular formula C15H24NO2P and a molecular weight of 281.34 g/mol. Its IUPAC name is N-[[methyl(2-methylpentyl)phosphoryl]methyl]benzamide.
| Compound Name | N-[[methyl(2-methylpentyl)phosphoryl]methyl]benzamide |
|---|---|
| PubChem CID | 21338268 |
| Molecular Formula | C15H24NO2P |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | N-[[methyl(2-methylpentyl)phosphoryl]methyl]benzamide |
| SMILES | CCCC(C)CP(C)(=O)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H24NO2P/c1-4-8-13(2)11-19(3,18)12-16-15(17)14-9-6-5-7-10-14/h5-7,9-10,13H,4,8,11-12H2,1-3H3,(H,16,17) |
| InChIKey | SSAKYVHTTRORJG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|