C14H14N2O4S — CID 54512538
N-(8,9-dimethoxy-3-oxo-5,6-dihydro-[1,3]thiazolo[4,3-a]isoquinolin-1-yl)formamide (PubChem CID 54512538) has the molecular formula C14H14N2O4S and a molecular weight of 306.34 g/mol. Its IUPAC name is N-(8,9-dimethoxy-3-oxo-5,6-dihydro-[1,3]thiazolo[4,3-a]isoquinolin-1-yl)formamide.
| Compound Name | N-(8,9-dimethoxy-3-oxo-5,6-dihydro-[1,3]thiazolo[4,3-a]isoquinolin-1-yl)formamide |
|---|---|
| PubChem CID | 54512538 |
| Molecular Formula | C14H14N2O4S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | N-(8,9-dimethoxy-3-oxo-5,6-dihydro-[1,3]thiazolo[4,3-a]isoquinolin-1-yl)formamide |
| SMILES | COc1cc2c(cc1OC)-c1c(NC=O)sc(=O)n1CC2 |
| InChI | InChI=1S/C14H14N2O4S/c1-19-10-5-8-3-4-16-12(9(8)6-11(10)20-2)13(15-7-17)21-14(16)18/h5-7H,3-4H2,1-2H3,(H,15,17) |
| InChIKey | YKDSCPYKUDCBSY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|