C11H16N3O2S- — CID 54519393
5-[2-amino-2-[methyl(sulfinato)amino]ethyl]-2,3-dihydro-1H-indole (PubChem CID 54519393) has the molecular formula C11H16N3O2S- and a molecular weight of 254.33 g/mol. Its IUPAC name is 5-[2-amino-2-[methyl(sulfinato)amino]ethyl]-2,3-dihydro-1H-indole.
| Compound Name | 5-[2-amino-2-[methyl(sulfinato)amino]ethyl]-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 54519393 |
| Molecular Formula | C11H16N3O2S- |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 5-[2-amino-2-[methyl(sulfinato)amino]ethyl]-2,3-dihydro-1H-indole |
| SMILES | CN(C(N)Cc1ccc2c(c1)CCN2)S(=O)[O-] |
| InChI | InChI=1S/C11H17N3O2S/c1-14(17(15)16)11(12)7-8-2-3-10-9(6-8)4-5-13-10/h2-3,6,11,13H,4-5,7,12H2,1H3,(H,15,16)/p-1 |
| InChIKey | XIRZUXGLDKSMAO-UHFFFAOYSA-M |
| XLogP | 0.21 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|