C27H32F10N2O3 — CID 54520035
5-[(3R)-3-fluorohexoxy]-2-[4-[6-[2,2,3,3-tetrafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propoxy]hexyl]phenyl]pyrimidine (PubChem CID 54520035) has the molecular formula C27H32F10N2O3 and a molecular weight of 622.54 g/mol. Its IUPAC name is 5-[(3R)-3-fluorohexoxy]-2-[4-[6-[2,2,3,3-tetrafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propoxy]hexyl]phenyl]pyrimidine.
| Compound Name | 5-[(3R)-3-fluorohexoxy]-2-[4-[6-[2,2,3,3-tetrafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propoxy]hexyl]phenyl]pyrimidine |
|---|---|
| PubChem CID | 54520035 |
| Molecular Formula | C27H32F10N2O3 |
| Molecular Weight | 622.54 g/mol |
| Exact Mass | 622.23 |
| IUPAC Name | 5-[(3R)-3-fluorohexoxy]-2-[4-[6-[2,2,3,3-tetrafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propoxy]hexyl]phenyl]pyrimidine |
| SMILES | CCC[C@@H](F)CCOc1cnc(-c2ccc(CCCCCCOCC(F)(F)C(F)(F)OC(F)(F)C(F)(F)F)cc2)nc1 |
| InChI | InChI=1S/C27H32F10N2O3/c1-2-7-21(28)13-15-41-22-16-38-23(39-17-22)20-11-9-19(10-12-20)8-5-3-4-6-14-40-18-24(29,30)26(34,35)42-27(36,37)25(31,32)33/h9-12,16-17,21H,2-8,13-15,18H2,1H3/t21-/m1/s1 |
| InChIKey | YPDPAKMKSBOEGY-OAQYLSRUSA-N |
| XLogP | 8.57 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.54 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|