C19H20O5 — CID 54520651
tert-butyl 2-[(3-oxo-1,2-dihydrobenzo[f]chromen-8-yl)oxy]acetate (PubChem CID 54520651) has the molecular formula C19H20O5 and a molecular weight of 328.36 g/mol. Its IUPAC name is tert-butyl 2-[(3-oxo-1,2-dihydrobenzo[f]chromen-8-yl)oxy]acetate.
| Compound Name | tert-butyl 2-[(3-oxo-1,2-dihydrobenzo[f]chromen-8-yl)oxy]acetate |
|---|---|
| PubChem CID | 54520651 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | tert-butyl 2-[(3-oxo-1,2-dihydrobenzo[f]chromen-8-yl)oxy]acetate |
| SMILES | CC(C)(C)OC(=O)COc1ccc2c3c(ccc2c1)OC(=O)CC3 |
| InChI | InChI=1S/C19H20O5/c1-19(2,3)24-18(21)11-22-13-5-6-14-12(10-13)4-8-16-15(14)7-9-17(20)23-16/h4-6,8,10H,7,9,11H2,1-3H3 |
| InChIKey | YPOGGVAZKXVLEG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|