About N-butyl-2-diazoacetamide
N-butyl-2-diazoacetamide (PubChem CID 54521755) has the molecular formula C6H11N3O
and a molecular weight of 141.17 g/mol. Its IUPAC name is N-butyl-2-diazoacetamide.
Molecular Properties
| Compound Name | N-butyl-2-diazoacetamide |
| PubChem CID | 54521755 |
| Molecular Formula | C6H11N3O |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.09 |
| IUPAC Name | N-butyl-2-diazoacetamide |
| SMILES | CCCCNC(=O)C=[N+]=[N-] |
| InChI | InChI=1S/C6H11N3O/c1-2-3-4-8-6(10)5-9-7/h5H,2-4H2,1H3,(H,8,10) |
| InChIKey | YQHLOLWNBKNDSL-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-2-diazoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2-diazoacetamide?
The IUPAC name of N-butyl-2-diazoacetamide (CID 54521755) is N-butyl-2-diazoacetamide.
What is the SMILES notation for N-butyl-2-diazoacetamide?
The canonical SMILES for N-butyl-2-diazoacetamide is CCCCNC(=O)C=[N+]=[N-].
What is the InChIKey of N-butyl-2-diazoacetamide?
The InChIKey is YQHLOLWNBKNDSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O/c1-2-3-4-8-6(10)5-9-7/h5H,2-4H2,1H3,(H,8,10).
What are the key properties of N-butyl-2-diazoacetamide?
N-butyl-2-diazoacetamide has a molecular weight of 141.17 g/mol, XLogP of 0.20, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2-diazoacetamide is sourced from PubChem (CID 54521755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).