C20H15NO7 — CID 54522503
(2,5-dihydroxypyrrol-1-yl) 9H-fluoren-9-ylmethoxycarbonyl carbonate (PubChem CID 54522503) has the molecular formula C20H15NO7 and a molecular weight of 381.34 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 9H-fluoren-9-ylmethoxycarbonyl carbonate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 9H-fluoren-9-ylmethoxycarbonyl carbonate |
|---|---|
| PubChem CID | 54522503 |
| Molecular Formula | C20H15NO7 |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 9H-fluoren-9-ylmethoxycarbonyl carbonate |
| SMILES | O=C(OCC1c2ccccc2-c2ccccc21)OC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C20H15NO7/c22-17-9-10-18(23)21(17)28-20(25)27-19(24)26-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-10,16,22-23H,11H2 |
| InChIKey | YQUSXRRBRAEYST-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|