C26H26N2O7S — CID 91211412
(2,5-dihydroxypyrrol-1-yl) 5-acetylsulfanyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoate (PubChem CID 91211412) has the molecular formula C26H26N2O7S and a molecular weight of 510.57 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 5-acetylsulfanyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 5-acetylsulfanyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 91211412 |
| Molecular Formula | C26H26N2O7S |
| Molecular Weight | 510.57 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 5-acetylsulfanyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoate |
| SMILES | CC(=O)SCCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C26H26N2O7S/c1-16(29)36-14-6-11-22(25(32)35-28-23(30)12-13-24(28)31)27-26(33)34-15-21-19-9-4-2-7-17(19)18-8-3-5-10-20(18)21/h2-5,7-10,12-13,21-22,30-31H,6,11,14-15H2,1H3,(H,27,33) |
| InChIKey | XTIGIGCIJAVLCR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|