C36H44N4O11S — CID 89140306
3-[6-[[5-acetylsulfanyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoyl]amino]hexanoylamino]-4-[(1-carboxy-3-oxopropan-2-yl)amino]-4-oxobutanoic acid (PubChem CID 89140306) has the molecular formula C36H44N4O11S and a molecular weight of 740.83 g/mol. Its IUPAC name is 3-[6-[[5-acetylsulfanyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoyl]amino]hexanoylamino]-4-[(1-carboxy-3-oxopropan-2-yl)amino]-4-oxobutanoic acid.
| Compound Name | 3-[6-[[5-acetylsulfanyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoyl]amino]hexanoylamino]-4-[(1-carboxy-3-oxopropan-2-yl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 89140306 |
| Molecular Formula | C36H44N4O11S |
| Molecular Weight | 740.83 g/mol |
| Exact Mass | 740.27 |
| IUPAC Name | 3-[6-[[5-acetylsulfanyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoyl]amino]hexanoylamino]-4-[(1-carboxy-3-oxopropan-2-yl)amino]-4-oxobutanoic acid |
| SMILES | CC(=O)SCCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NCCCCCC(=O)NC(CC(=O)O)C(=O)NC(C=O)CC(=O)O |
| InChI | InChI=1S/C36H44N4O11S/c1-22(42)52-17-9-14-29(40-36(50)51-21-28-26-12-6-4-10-24(26)25-11-5-7-13-27(25)28)34(48)37-16-8-2-3-15-31(43)39-30(19-33(46)47)35(49)38-23(20-41)18-32(44)45/h4-7,10-13,20,23,28-30H,2-3,8-9,14-19,21H2,1H3,(H,37,48)(H,38,49)(H,39,43)(H,40,50)(H,44,45)(H,46,47) |
| InChIKey | XDBYFDKVOZRVOV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 234.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.83 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|