C20H23IN2O5S — CID 54523418
benzyl (6S)-3-(1-hydroxybutyl)-7-[(2-iodoacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate (PubChem CID 54523418) has the molecular formula C20H23IN2O5S and a molecular weight of 530.38 g/mol. Its IUPAC name is benzyl (6S)-3-(1-hydroxybutyl)-7-[(2-iodoacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate.
| Compound Name | benzyl (6S)-3-(1-hydroxybutyl)-7-[(2-iodoacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate |
|---|---|
| PubChem CID | 54523418 |
| Molecular Formula | C20H23IN2O5S |
| Molecular Weight | 530.38 g/mol |
| Exact Mass | 530.04 |
| IUPAC Name | benzyl (6S)-3-(1-hydroxybutyl)-7-[(2-iodoacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate |
| SMILES | CCCC(O)C1=CS[C@H]2C(NC(=O)CI)C(=O)N2C1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H23IN2O5S/c1-2-6-14(24)13-11-29-19-16(22-15(25)9-21)18(26)23(19)17(13)20(27)28-10-12-7-4-3-5-8-12/h3-5,7-8,11,14,16-17,19,24H,2,6,9-10H2,1H3,(H,22,25)/t14?,16?,17?,19-/m0/s1 |
| InChIKey | YRLDYXLMDJDXRY-XSVWMXEQSA-N |
| XLogP | 1.98 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|