C17H21FN4O4 — CID 54525233
N-[[(4S)-3-[3-fluoro-4-(4-nitrosopiperidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-4-yl]methyl]acetamide (PubChem CID 54525233) has the molecular formula C17H21FN4O4 and a molecular weight of 364.38 g/mol. Its IUPAC name is N-[[(4S)-3-[3-fluoro-4-(4-nitrosopiperidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-4-yl]methyl]acetamide.
| Compound Name | N-[[(4S)-3-[3-fluoro-4-(4-nitrosopiperidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 54525233 |
| Molecular Formula | C17H21FN4O4 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N-[[(4S)-3-[3-fluoro-4-(4-nitrosopiperidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-4-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1COC(=O)N1c1ccc(N2CCC(N=O)CC2)c(F)c1 |
| InChI | InChI=1S/C17H21FN4O4/c1-11(23)19-9-14-10-26-17(24)22(14)13-2-3-16(15(18)8-13)21-6-4-12(20-25)5-7-21/h2-3,8,12,14H,4-7,9-10H2,1H3,(H,19,23)/t14-/m0/s1 |
| InChIKey | YSQYRVKGAXOEKY-AWEZNQCLSA-N |
| XLogP | 2.02 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|