C16H20FN3O5 — CID 170454918
N-[[(5S)-3-(3-fluoro-4-morpholin-4-ylphenyl)-4-hydroxy-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 170454918) has the molecular formula C16H20FN3O5 and a molecular weight of 353.35 g/mol. Its IUPAC name is N-[[(5S)-3-(3-fluoro-4-morpholin-4-ylphenyl)-4-hydroxy-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-(3-fluoro-4-morpholin-4-ylphenyl)-4-hydroxy-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 170454918 |
| Molecular Formula | C16H20FN3O5 |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | N-[[(5S)-3-(3-fluoro-4-morpholin-4-ylphenyl)-4-hydroxy-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@@H]1OC(=O)N(c2ccc(N3CCOCC3)c(F)c2)C1O |
| InChI | InChI=1S/C16H20FN3O5/c1-10(21)18-9-14-15(22)20(16(23)25-14)11-2-3-13(12(17)8-11)19-4-6-24-7-5-19/h2-3,8,14-15,22H,4-7,9H2,1H3,(H,18,21)/t14-,15?/m0/s1 |
| InChIKey | JPKBGHHGCHDIAM-MLCCFXAWSA-N |
| XLogP | 0.44 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|