C25H27FN2O2 — CID 54527578
3-ethoxy-1-[4-(4-fluorophenyl)-2-(4-methylphenyl)-6-propan-2-ylpyrimidin-5-yl]prop-2-en-1-ol (PubChem CID 54527578) has the molecular formula C25H27FN2O2 and a molecular weight of 406.50 g/mol. Its IUPAC name is 3-ethoxy-1-[4-(4-fluorophenyl)-2-(4-methylphenyl)-6-propan-2-ylpyrimidin-5-yl]prop-2-en-1-ol.
| Compound Name | 3-ethoxy-1-[4-(4-fluorophenyl)-2-(4-methylphenyl)-6-propan-2-ylpyrimidin-5-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 54527578 |
| Molecular Formula | C25H27FN2O2 |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 3-ethoxy-1-[4-(4-fluorophenyl)-2-(4-methylphenyl)-6-propan-2-ylpyrimidin-5-yl]prop-2-en-1-ol |
| SMILES | CCOC=CC(O)c1c(-c2ccc(F)cc2)nc(-c2ccc(C)cc2)nc1C(C)C |
| InChI | InChI=1S/C25H27FN2O2/c1-5-30-15-14-21(29)22-23(16(2)3)27-25(19-8-6-17(4)7-9-19)28-24(22)18-10-12-20(26)13-11-18/h6-16,21,29H,5H2,1-4H3 |
| InChIKey | YUEYYRCLLJJYHI-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|