C17H20ClNO6S — CID 54528386
[2-chloro-3-(2-methoxyethoxy)-4-methylsulfonylphenyl]-(5-propan-2-yl-1,2-oxazol-4-yl)methanone (PubChem CID 54528386) has the molecular formula C17H20ClNO6S and a molecular weight of 401.87 g/mol. Its IUPAC name is [2-chloro-3-(2-methoxyethoxy)-4-methylsulfonylphenyl]-(5-propan-2-yl-1,2-oxazol-4-yl)methanone.
| Compound Name | [2-chloro-3-(2-methoxyethoxy)-4-methylsulfonylphenyl]-(5-propan-2-yl-1,2-oxazol-4-yl)methanone |
|---|---|
| PubChem CID | 54528386 |
| Molecular Formula | C17H20ClNO6S |
| Molecular Weight | 401.87 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | [2-chloro-3-(2-methoxyethoxy)-4-methylsulfonylphenyl]-(5-propan-2-yl-1,2-oxazol-4-yl)methanone |
| SMILES | COCCOc1c(S(C)(=O)=O)ccc(C(=O)c2cnoc2C(C)C)c1Cl |
| InChI | InChI=1S/C17H20ClNO6S/c1-10(2)16-12(9-19-25-16)15(20)11-5-6-13(26(4,21)22)17(14(11)18)24-8-7-23-3/h5-6,9-10H,7-8H2,1-4H3 |
| InChIKey | YUTDJNIAQZNWLI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 95.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.87 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|