C12H24O4 — CID 545346
2,3-bis[(2-methylpropan-2-yl)oxy]-1,4-dioxane (PubChem CID 545346) has the molecular formula C12H24O4 and a molecular weight of 232.32 g/mol. Its IUPAC name is 2,3-bis[(2-methylpropan-2-yl)oxy]-1,4-dioxane.
| Compound Name | 2,3-bis[(2-methylpropan-2-yl)oxy]-1,4-dioxane |
|---|---|
| PubChem CID | 545346 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 2,3-bis[(2-methylpropan-2-yl)oxy]-1,4-dioxane |
| SMILES | CC(C)(C)OC1OCCOC1OC(C)(C)C |
| InChI | InChI=1S/C12H24O4/c1-11(2,3)15-9-10(14-8-7-13-9)16-12(4,5)6/h9-10H,7-8H2,1-6H3 |
| InChIKey | UNMVIWYPFPYOJZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |