C22H28NO4P — CID 54534773
benzyl 2-[2-(4-aminophenyl)-1-methoxy-1-phosphorosoethyl]-4-methylpentanoate (PubChem CID 54534773) has the molecular formula C22H28NO4P and a molecular weight of 401.44 g/mol. Its IUPAC name is benzyl 2-[2-(4-aminophenyl)-1-methoxy-1-phosphorosoethyl]-4-methylpentanoate.
| Compound Name | benzyl 2-[2-(4-aminophenyl)-1-methoxy-1-phosphorosoethyl]-4-methylpentanoate |
|---|---|
| PubChem CID | 54534773 |
| Molecular Formula | C22H28NO4P |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | benzyl 2-[2-(4-aminophenyl)-1-methoxy-1-phosphorosoethyl]-4-methylpentanoate |
| SMILES | COC(Cc1ccc(N)cc1)(P=O)C(CC(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H28NO4P/c1-16(2)13-20(21(24)27-15-18-7-5-4-6-8-18)22(26-3,28-25)14-17-9-11-19(23)12-10-17/h4-12,16,20H,13-15,23H2,1-3H3 |
| InChIKey | IZNQGQRUXXFDEZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|