C24H34ClO3P — CID 54536279
2-[[chloro(ethoxy)phosphoryl]methyl]-1-phenylmethoxy-4-(2,4,4-trimethylpentan-2-yl)benzene (PubChem CID 54536279) has the molecular formula C24H34ClO3P and a molecular weight of 436.96 g/mol. Its IUPAC name is 2-[[chloro(ethoxy)phosphoryl]methyl]-1-phenylmethoxy-4-(2,4,4-trimethylpentan-2-yl)benzene.
| Compound Name | 2-[[chloro(ethoxy)phosphoryl]methyl]-1-phenylmethoxy-4-(2,4,4-trimethylpentan-2-yl)benzene |
|---|---|
| PubChem CID | 54536279 |
| Molecular Formula | C24H34ClO3P |
| Molecular Weight | 436.96 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 2-[[chloro(ethoxy)phosphoryl]methyl]-1-phenylmethoxy-4-(2,4,4-trimethylpentan-2-yl)benzene |
| SMILES | CCOP(=O)(Cl)Cc1cc(C(C)(C)CC(C)(C)C)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H34ClO3P/c1-7-28-29(25,26)17-20-15-21(24(5,6)18-23(2,3)4)13-14-22(20)27-16-19-11-9-8-10-12-19/h8-15H,7,16-18H2,1-6H3 |
| InChIKey | YZZQOEHSJUTWTG-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.96 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|