C24H20F6NO4S2+ — CID 54536715
2,2-bis-(4-methylphenyl)sulfonyl-4,5-bis(trifluoromethyl)-1,3-dihydroisoindol-2-ium (PubChem CID 54536715) has the molecular formula C24H20F6NO4S2+ and a molecular weight of 564.55 g/mol. Its IUPAC name is 2,2-bis-(4-methylphenyl)sulfonyl-4,5-bis(trifluoromethyl)-1,3-dihydroisoindol-2-ium.
| Compound Name | 2,2-bis-(4-methylphenyl)sulfonyl-4,5-bis(trifluoromethyl)-1,3-dihydroisoindol-2-ium |
|---|---|
| PubChem CID | 54536715 |
| Molecular Formula | C24H20F6NO4S2+ |
| Molecular Weight | 564.55 g/mol |
| Exact Mass | 564.07 |
| IUPAC Name | 2,2-bis-(4-methylphenyl)sulfonyl-4,5-bis(trifluoromethyl)-1,3-dihydroisoindol-2-ium |
| SMILES | Cc1ccc(S(=O)(=O)[N+]2(S(=O)(=O)c3ccc(C)cc3)Cc3ccc(C(F)(F)F)c(C(F)(F)F)c3C2)cc1 |
| InChI | InChI=1S/C24H20F6NO4S2/c1-15-3-8-18(9-4-15)36(32,33)31(37(34,35)19-10-5-16(2)6-11-19)13-17-7-12-21(23(25,26)27)22(20(17)14-31)24(28,29)30/h3-12H,13-14H2,1-2H3/q+1 |
| InChIKey | UMSGONMYWMLYEG-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.55 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|