C11H19O2PS2 — CID 54537627
[(1S)-2-bicyclo[2.2.1]hept-5-enyl]sulfanyl-diethoxy-sulfanylidene-λ5-phosphane (PubChem CID 54537627) has the molecular formula C11H19O2PS2 and a molecular weight of 278.38 g/mol. Its IUPAC name is [(1S)-2-bicyclo[2.2.1]hept-5-enyl]sulfanyl-diethoxy-sulfanylidene-λ5-phosphane.
| Compound Name | [(1S)-2-bicyclo[2.2.1]hept-5-enyl]sulfanyl-diethoxy-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 54537627 |
| Molecular Formula | C11H19O2PS2 |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | [(1S)-2-bicyclo[2.2.1]hept-5-enyl]sulfanyl-diethoxy-sulfanylidene-λ5-phosphane |
| SMILES | CCOP(=S)(OCC)SC1CC2C=C[C@@H]1C2 |
| InChI | InChI=1S/C11H19O2PS2/c1-3-12-14(15,13-4-2)16-11-8-9-5-6-10(11)7-9/h5-6,9-11H,3-4,7-8H2,1-2H3/t9?,10-,11?/m1/s1 |
| InChIKey | ZAXPWJMOBFXJPN-HSOILSAZSA-N |
| XLogP | 3.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|