About 2-bicyclo[2.2.1]hept-5-enylmethanol;hydroperoxyethane
2-bicyclo[2.2.1]hept-5-enylmethanol;hydroperoxyethane (PubChem CID 87177397) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]hept-5-enylmethanol;hydroperoxyethane.
Molecular Properties
| Compound Name | 2-bicyclo[2.2.1]hept-5-enylmethanol;hydroperoxyethane |
| PubChem CID | 87177397 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 2-bicyclo[2.2.1]hept-5-enylmethanol;hydroperoxyethane |
| SMILES | CCOO.OCC1CC2C=CC1C2 |
| InChI | InChI=1S/C8H12O.C2H6O2/c9-5-8-4-6-1-2-7(8)3-6;1-2-4-3/h1-2,6-9H,3-5H2;3H,2H2,1H3 |
| InChIKey | GMKMQYMIOGHFTK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-bicyclo[2.2.1]hept-5-enylmethanol;hydroperoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bicyclo[2.2.1]hept-5-enylmethanol;hydroperoxyethane?
The IUPAC name of 2-bicyclo[2.2.1]hept-5-enylmethanol;hydroperoxyethane (CID 87177397) is 2-bicyclo[2.2.1]hept-5-enylmethanol;hydroperoxyethane.
What is the SMILES notation for 2-bicyclo[2.2.1]hept-5-enylmethanol;hydroperoxyethane?
The canonical SMILES for 2-bicyclo[2.2.1]hept-5-enylmethanol;hydroperoxyethane is CCOO.OCC1CC2C=CC1C2.
What is the InChIKey of 2-bicyclo[2.2.1]hept-5-enylmethanol;hydroperoxyethane?
The InChIKey is GMKMQYMIOGHFTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O.C2H6O2/c9-5-8-4-6-1-2-7(8)3-6;1-2-4-3/h1-2,6-9H,3-5H2;3H,2H2,1H3.
What are the key properties of 2-bicyclo[2.2.1]hept-5-enylmethanol;hydroperoxyethane?
2-bicyclo[2.2.1]hept-5-enylmethanol;hydroperoxyethane has a molecular weight of 186.25 g/mol, XLogP of 1.69, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bicyclo[2.2.1]hept-5-enylmethanol;hydroperoxyethane is sourced from PubChem (CID 87177397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).