C16H24O2 — CID 158818831
2-bicyclo[2.2.1]hept-5-enylmethanol;cyclopenta-1,3-diene;prop-2-en-1-ol (PubChem CID 158818831) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]hept-5-enylmethanol;cyclopenta-1,3-diene;prop-2-en-1-ol.
| Compound Name | 2-bicyclo[2.2.1]hept-5-enylmethanol;cyclopenta-1,3-diene;prop-2-en-1-ol |
|---|---|
| PubChem CID | 158818831 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 2-bicyclo[2.2.1]hept-5-enylmethanol;cyclopenta-1,3-diene;prop-2-en-1-ol |
| SMILES | C1=CCC=C1.C=CCO.OCC1CC2C=CC1C2 |
| InChI | InChI=1S/C8H12O.C5H6.C3H6O/c9-5-8-4-6-1-2-7(8)3-6;1-2-4-5-3-1;1-2-3-4/h1-2,6-9H,3-5H2;1-4H,5H2;2,4H,1,3H2 |
| InChIKey | IVPMXGJRTQSRIX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|