C10H11F3N2OS2 — CID 54538331
3,4,4-trifluorobut-3-enyl N-(4,5-dimethyl-1,3-oxazol-2-yl)carbamodithioate (PubChem CID 54538331) has the molecular formula C10H11F3N2OS2 and a molecular weight of 296.34 g/mol. Its IUPAC name is 3,4,4-trifluorobut-3-enyl N-(4,5-dimethyl-1,3-oxazol-2-yl)carbamodithioate.
| Compound Name | 3,4,4-trifluorobut-3-enyl N-(4,5-dimethyl-1,3-oxazol-2-yl)carbamodithioate |
|---|---|
| PubChem CID | 54538331 |
| Molecular Formula | C10H11F3N2OS2 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 3,4,4-trifluorobut-3-enyl N-(4,5-dimethyl-1,3-oxazol-2-yl)carbamodithioate |
| SMILES | Cc1nc(NC(=S)SCCC(F)=C(F)F)oc1C |
| InChI | InChI=1S/C10H11F3N2OS2/c1-5-6(2)16-9(14-5)15-10(17)18-4-3-7(11)8(12)13/h3-4H2,1-2H3,(H,14,15,17) |
| InChIKey | ZBIZFWZPLXPGCC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|