C15H10ClN5 — CID 54540965
2-(6-chloro-3-pyridinyl)-5,6-dihydropyrimido[4,5-f]quinazoline (PubChem CID 54540965) has the molecular formula C15H10ClN5 and a molecular weight of 295.73 g/mol. Its IUPAC name is 2-(6-chloro-3-pyridinyl)-5,6-dihydropyrimido[4,5-f]quinazoline.
| Compound Name | 2-(6-chloro-3-pyridinyl)-5,6-dihydropyrimido[4,5-f]quinazoline |
|---|---|
| PubChem CID | 54540965 |
| Molecular Formula | C15H10ClN5 |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 2-(6-chloro-3-pyridinyl)-5,6-dihydropyrimido[4,5-f]quinazoline |
| SMILES | Clc1ccc(-c2ncc3c(n2)-c2cncnc2CC3)cn1 |
| InChI | InChI=1S/C15H10ClN5/c16-13-4-2-10(6-18-13)15-19-5-9-1-3-12-11(14(9)21-15)7-17-8-20-12/h2,4-8H,1,3H2 |
| InChIKey | ZDECCOLHCQVKKL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|