C14H16O5 — CID 54542362
4-methoxy-3-(7-oxabicyclo[2.2.1]heptan-2-yloxy)benzoic acid (PubChem CID 54542362) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is 4-methoxy-3-(7-oxabicyclo[2.2.1]heptan-2-yloxy)benzoic acid.
| Compound Name | 4-methoxy-3-(7-oxabicyclo[2.2.1]heptan-2-yloxy)benzoic acid |
|---|---|
| PubChem CID | 54542362 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 4-methoxy-3-(7-oxabicyclo[2.2.1]heptan-2-yloxy)benzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1OC1CC2CCC1O2 |
| InChI | InChI=1S/C14H16O5/c1-17-10-4-2-8(14(15)16)6-12(10)19-13-7-9-3-5-11(13)18-9/h2,4,6,9,11,13H,3,5,7H2,1H3,(H,15,16) |
| InChIKey | ZEDATKZHSDPGIY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |